C19H25N5OS2 — CID 7933831
1-butyl-3-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]thiourea (PubChem CID 7933831) has the molecular formula C19H25N5OS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is 1-butyl-3-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]thiourea.
| Compound Name | 1-butyl-3-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 7933831 |
| Molecular Formula | C19H25N5OS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-butyl-3-[(Z)-1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]thiourea |
| SMILES | CCCCNC(=S)N/N=C(/C)c1ccc(OC)c(CSc2ncccn2)c1 |
| InChI | InChI=1S/C19H25N5OS2/c1-4-5-9-20-18(26)24-23-14(2)15-7-8-17(25-3)16(12-15)13-27-19-21-10-6-11-22-19/h6-8,10-12H,4-5,9,13H2,1-3H3,(H2,20,24,26)/b23-14- |
| InChIKey | QMFVFVDJLYEXGP-UCQKPKSFSA-N |
| XLogP | 3.77 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|