C20H20FN3O2 — CID 42165042
[(3S)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-(3-methylfuran-2-yl)methanone (PubChem CID 42165042) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is [(3S)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-(3-methylfuran-2-yl)methanone.
| Compound Name | [(3S)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-(3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 42165042 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [(3S)-3-[4-(3-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-(3-methylfuran-2-yl)methanone |
| SMILES | Cc1ccoc1C(=O)N1CCC[C@H](c2[nH]ncc2-c2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H20FN3O2/c1-13-7-9-26-19(13)20(25)24-8-3-5-15(12-24)18-17(11-22-23-18)14-4-2-6-16(21)10-14/h2,4,6-7,9-11,15H,3,5,8,12H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | RSJOIUHZPQVDJA-HNNXBMFYSA-N |
| XLogP | 4.14 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |