C24H21N5O4S — CID 42165056
N-[[7-(imidazo[2,1-b][1,3]thiazole-6-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42165056) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-[[7-(imidazo[2,1-b][1,3]thiazole-6-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[7-(imidazo[2,1-b][1,3]thiazole-6-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42165056 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[[7-(imidazo[2,1-b][1,3]thiazole-6-carbonyl)-3-methyl-6,8-dihydro-5H-2,7-naphthyridin-4-yl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ncc2c(c1CNC(=O)c1ccc3c(c1)OCO3)CCN(C(=O)c1cn3ccsc3n1)C2 |
| InChI | InChI=1S/C24H21N5O4S/c1-14-18(10-26-22(30)15-2-3-20-21(8-15)33-13-32-20)17-4-5-28(11-16(17)9-25-14)23(31)19-12-29-6-7-34-24(29)27-19/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H,26,30) |
| InChIKey | ALNGPLYEKOVBKJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |