C13H22N4 — CID 42166790
3-methyl-7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 42166790) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 3-methyl-7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 3-methyl-7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 42166790 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 3-methyl-7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | Cc1nnc2n1CCN(C/C=C/C(C)C)CC2 |
| InChI | InChI=1S/C13H22N4/c1-11(2)5-4-7-16-8-6-13-15-14-12(3)17(13)10-9-16/h4-5,11H,6-10H2,1-3H3/b5-4+ |
| InChIKey | NIBFCHILZKEPQI-SNAWJCMRSA-N |
| XLogP | 1.66 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|