C26H34N2O4 — CID 42167921
(2S)-6-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-[2-(3-methoxyphenyl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42167921) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2S)-6-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-[2-(3-methoxyphenyl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-6-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-[2-(3-methoxyphenyl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42167921 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2S)-6-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-[2-(3-methoxyphenyl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | CCOc1cccc(CN2CCC3(CC2)C[C@@H]3C(=O)NCCc2cccc(OC)c2)c1O |
| InChI | InChI=1S/C26H34N2O4/c1-3-32-23-9-5-7-20(24(23)29)18-28-14-11-26(12-15-28)17-22(26)25(30)27-13-10-19-6-4-8-21(16-19)31-2/h4-9,16,22,29H,3,10-15,17-18H2,1-2H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | PYMPHJVJYGQNPM-JOCHJYFZSA-N |
| XLogP | 3.76 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|