C22H24Cl2N2O3S — CID 4216853
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzamide (PubChem CID 4216853) has the molecular formula C22H24Cl2N2O3S and a molecular weight of 467.42 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4216853 |
| Molecular Formula | C22H24Cl2N2O3S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-chloro-3-[(4-chlorophenyl)sulfamoyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H24Cl2N2O3S/c1-13(19-11-14-2-3-15(19)10-14)25-22(27)16-4-9-20(24)21(12-16)30(28,29)26-18-7-5-17(23)6-8-18/h4-9,12-15,19,26H,2-3,10-11H2,1H3,(H,25,27) |
| InChIKey | OAWGIORAXWUGLV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |