C22H25FN2O3S — CID 43009015
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 43009015) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43009015 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-4-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H25FN2O3S/c1-14(21-13-15-2-3-17(21)12-15)24-22(26)16-4-10-20(11-5-16)29(27,28)25-19-8-6-18(23)7-9-19/h4-11,14-15,17,21,25H,2-3,12-13H2,1H3,(H,24,26) |
| InChIKey | ALPFJDDSNBEUCH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |