C26H27FN4O3 — CID 42169692
[7-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(1-oxidopyridin-1-ium-4-yl)methanone (PubChem CID 42169692) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is [7-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(1-oxidopyridin-1-ium-4-yl)methanone.
| Compound Name | [7-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
|---|---|
| PubChem CID | 42169692 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | [7-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
| SMILES | O=C(c1cc[n+]([O-])cc1)N1CCOc2ccc(CN3CCN(c4ccc(F)cc4)CC3)cc2C1 |
| InChI | InChI=1S/C26H27FN4O3/c27-23-2-4-24(5-3-23)29-13-11-28(12-14-29)18-20-1-6-25-22(17-20)19-30(15-16-34-25)26(32)21-7-9-31(33)10-8-21/h1-10,17H,11-16,18-19H2 |
| InChIKey | NWDOFSHZBHLUFK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|