C25H25ClN4O5S — CID 4217336
2-[[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]-N-phenylbenzamide (PubChem CID 4217336) has the molecular formula C25H25ClN4O5S and a molecular weight of 529.02 g/mol. Its IUPAC name is 2-[[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 4217336 |
| Molecular Formula | C25H25ClN4O5S |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CNc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H25ClN4O5S/c26-21-11-10-19(16-23(21)36(33,34)30-12-14-35-15-13-30)28-24(31)17-27-22-9-5-4-8-20(22)25(32)29-18-6-2-1-3-7-18/h1-11,16,27H,12-15,17H2,(H,28,31)(H,29,32) |
| InChIKey | BOXNDIPUMOMCHI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |