C20H28N4O4S — CID 42173441
ethyl (3S)-1-[4-[6-(cyclopropanecarbonylamino)pyridazin-3-yl]sulfanylbutanoyl]piperidine-3-carboxylate (PubChem CID 42173441) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is ethyl (3S)-1-[4-[6-(cyclopropanecarbonylamino)pyridazin-3-yl]sulfanylbutanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-[6-(cyclopropanecarbonylamino)pyridazin-3-yl]sulfanylbutanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42173441 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | ethyl (3S)-1-[4-[6-(cyclopropanecarbonylamino)pyridazin-3-yl]sulfanylbutanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)CCCSc2ccc(NC(=O)C3CC3)nn2)C1 |
| InChI | InChI=1S/C20H28N4O4S/c1-2-28-20(27)15-5-3-11-24(13-15)18(25)6-4-12-29-17-10-9-16(22-23-17)21-19(26)14-7-8-14/h9-10,14-15H,2-8,11-13H2,1H3,(H,21,22,26)/t15-/m0/s1 |
| InChIKey | PBUNDSZZDFYLNO-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|