C32H50N2O6S2 — CID 4217562
1-N,1-N'-bis(4-methoxyphenyl)-2,2-bis(octylsulfonyl)ethene-1,1-diamine (PubChem CID 4217562) has the molecular formula C32H50N2O6S2 and a molecular weight of 622.89 g/mol. Its IUPAC name is 1-N,1-N'-bis(4-methoxyphenyl)-2,2-bis(octylsulfonyl)ethene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(4-methoxyphenyl)-2,2-bis(octylsulfonyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 4217562 |
| Molecular Formula | C32H50N2O6S2 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 1-N,1-N'-bis(4-methoxyphenyl)-2,2-bis(octylsulfonyl)ethene-1,1-diamine |
| SMILES | CCCCCCCCS(=O)(=O)C(=C(Nc1ccc(OC)cc1)Nc1ccc(OC)cc1)S(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C32H50N2O6S2/c1-5-7-9-11-13-15-25-41(35,36)32(42(37,38)26-16-14-12-10-8-6-2)31(33-27-17-21-29(39-3)22-18-27)34-28-19-23-30(40-4)24-20-28/h17-24,33-34H,5-16,25-26H2,1-4H3 |
| InChIKey | ZNWMPOSTSLLFOG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|