C30H46N2O4S2 — CID 3963224
2,2-bis(octylsulfonyl)-1-N,1-N'-diphenylethene-1,1-diamine (PubChem CID 3963224) has the molecular formula C30H46N2O4S2 and a molecular weight of 562.84 g/mol. Its IUPAC name is 2,2-bis(octylsulfonyl)-1-N,1-N'-diphenylethene-1,1-diamine.
| Compound Name | 2,2-bis(octylsulfonyl)-1-N,1-N'-diphenylethene-1,1-diamine |
|---|---|
| PubChem CID | 3963224 |
| Molecular Formula | C30H46N2O4S2 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 2,2-bis(octylsulfonyl)-1-N,1-N'-diphenylethene-1,1-diamine |
| SMILES | CCCCCCCCS(=O)(=O)C(=C(Nc1ccccc1)Nc1ccccc1)S(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C30H46N2O4S2/c1-3-5-7-9-11-19-25-37(33,34)30(38(35,36)26-20-12-10-8-6-4-2)29(31-27-21-15-13-16-22-27)32-28-23-17-14-18-24-28/h13-18,21-24,31-32H,3-12,19-20,25-26H2,1-2H3 |
| InChIKey | UXQJITOLNULZLR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|