C24H26ClN3O6S — CID 4218159
N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-propan-2-ylamino]-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 4218159) has the molecular formula C24H26ClN3O6S and a molecular weight of 520.01 g/mol. Its IUPAC name is N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-propan-2-ylamino]-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-propan-2-ylamino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4218159 |
| Molecular Formula | C24H26ClN3O6S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-propan-2-ylamino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(C(C)C)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C24H26ClN3O6S/c1-17(2)27(35(32,33)21-11-12-22(25)23(13-21)28(30)31)16-24(29)26(14-19-7-5-4-6-8-19)15-20-10-9-18(3)34-20/h4-13,17H,14-16H2,1-3H3 |
| InChIKey | UZUQSFVNZMBFSE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|