C27H31ClN4O6S2 — CID 3273372
N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-morpholin-4-ylethyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 3273372) has the molecular formula C27H31ClN4O6S2 and a molecular weight of 607.15 g/mol. Its IUPAC name is N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-morpholin-4-ylethyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-morpholin-4-ylethyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3273372 |
| Molecular Formula | C27H31ClN4O6S2 |
| Molecular Weight | 607.15 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | N-benzyl-2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-morpholin-4-ylethyl)amino]-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(CCN2CCOCC2)S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C27H31ClN4O6S2/c1-21-7-8-23(39-21)19-30(18-22-5-3-2-4-6-22)27(33)20-31(12-11-29-13-15-38-16-14-29)40(36,37)24-9-10-25(28)26(17-24)32(34)35/h2-10,17H,11-16,18-20H2,1H3 |
| InChIKey | NPKJMHAWQNOKPJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|