C17H16F4N2O2S — CID 42190519
(3S)-N-(3,4-difluorophenyl)-1-(2,6-difluorophenyl)sulfonylpiperidin-3-amine (PubChem CID 42190519) has the molecular formula C17H16F4N2O2S and a molecular weight of 388.39 g/mol. Its IUPAC name is (3S)-N-(3,4-difluorophenyl)-1-(2,6-difluorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | (3S)-N-(3,4-difluorophenyl)-1-(2,6-difluorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 42190519 |
| Molecular Formula | C17H16F4N2O2S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (3S)-N-(3,4-difluorophenyl)-1-(2,6-difluorophenyl)sulfonylpiperidin-3-amine |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCC[C@H](Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H16F4N2O2S/c18-13-7-6-11(9-16(13)21)22-12-3-2-8-23(10-12)26(24,25)17-14(19)4-1-5-15(17)20/h1,4-7,9,12,22H,2-3,8,10H2/t12-/m0/s1 |
| InChIKey | COKRNYKHHHIMBI-LBPRGKRZSA-N |
| XLogP | 3.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |