C21H35N3O5S — CID 42197048
ethyl (2S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidine-2-carboxylate (PubChem CID 42197048) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is ethyl (2S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 42197048 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | ethyl (2S)-1-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCCN1Cc1cnc(S(=O)(=O)C2CCCC2)n1CCCOC |
| InChI | InChI=1S/C21H35N3O5S/c1-3-29-20(25)19-11-6-7-12-23(19)16-17-15-22-21(24(17)13-8-14-28-2)30(26,27)18-9-4-5-10-18/h15,18-19H,3-14,16H2,1-2H3/t19-/m0/s1 |
| InChIKey | KWONNBIKNRPDLW-IBGZPJMESA-N |
| XLogP | 2.55 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|