(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate

C9H15N5O4S — CID 4219798

IUPAC(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate
SMILES[H]/N=c1\nc(N2CCCCC2)cc(N)n1OS(=O)(=O)O
InChIInChI=1S/C9H15N5O4S/c10-7-6-8(13-4-2-1-3-5-13)12-9(11)14(7)18-19(15,16)17/h6,11H,1-5,10H2,(H,15,16,17)/b11-9+
InChIKeyDHVJQUFZGZOFFY-PKNBQFBNSA-N
MW289.32 g/mol
LogP-0.83
Rot. Bonds3

About (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate

(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate (PubChem CID 4219798) has the molecular formula C9H15N5O4S and a molecular weight of 289.32 g/mol. Its IUPAC name is (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate.

Molecular Properties

Compound Name(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate
PubChem CID4219798
Molecular FormulaC9H15N5O4S
Molecular Weight289.32 g/mol
Exact Mass289.08
IUPAC Name(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate
SMILES[H]/N=c1\nc(N2CCCCC2)cc(N)n1OS(=O)(=O)O
InChIInChI=1S/C9H15N5O4S/c10-7-6-8(13-4-2-1-3-5-13)12-9(11)14(7)18-19(15,16)17/h6,11H,1-5,10H2,(H,15,16,17)/b11-9+
InChIKeyDHVJQUFZGZOFFY-PKNBQFBNSA-N
XLogP-0.83
TPSA134.53 Ų
H-Bond Donors3
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.32
LogP ≤ 5-0.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate?
The IUPAC name of (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate (CID 4219798) is (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate.
What is the SMILES notation for (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate?
The canonical SMILES for (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate is [H]/N=c1\nc(N2CCCCC2)cc(N)n1OS(=O)(=O)O.
What is the InChIKey of (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate?
The InChIKey is DHVJQUFZGZOFFY-PKNBQFBNSA-N. The full InChI is InChI=1S/C9H15N5O4S/c10-7-6-8(13-4-2-1-3-5-13)12-9(11)14(7)18-19(15,16)17/h6,11H,1-5,10H2,(H,15,16,17)/b11-9+.
What are the key properties of (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate?
(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate has a molecular weight of 289.32 g/mol, XLogP of -0.83, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate is sourced from PubChem (CID 4219798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).