C9H15N5O4S — CID 4219798
(6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate (PubChem CID 4219798) has the molecular formula C9H15N5O4S and a molecular weight of 289.32 g/mol. Its IUPAC name is (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate.
| Compound Name | (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 4219798 |
| Molecular Formula | C9H15N5O4S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (6-amino-2-imino-4-piperidin-1-ylpyrimidin-1-yl) hydrogen sulfate |
| SMILES | [H]/N=c1\nc(N2CCCCC2)cc(N)n1OS(=O)(=O)O |
| InChI | InChI=1S/C9H15N5O4S/c10-7-6-8(13-4-2-1-3-5-13)12-9(11)14(7)18-19(15,16)17/h6,11H,1-5,10H2,(H,15,16,17)/b11-9+ |
| InChIKey | DHVJQUFZGZOFFY-PKNBQFBNSA-N |
| XLogP | -0.83 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|