C9H10N4S — CID 4219805
3-amino-4-benzyl-1H-1,2,4-triazole-5-thione (PubChem CID 4219805) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-amino-4-benzyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-benzyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4219805 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-amino-4-benzyl-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C9H10N4S/c10-8-11-12-9(14)13(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11)(H,12,14) |
| InChIKey | XECXPKJSLBZJDJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|