C26H27N3O2S — CID 4222600
N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenothiazin-10-ylpropanamide (PubChem CID 4222600) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenothiazin-10-ylpropanamide.
| Compound Name | N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenothiazin-10-ylpropanamide |
|---|---|
| PubChem CID | 4222600 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-3-phenothiazin-10-ylpropanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)CCN2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C26H27N3O2S/c1-18-12-13-19(2)20(16-18)27-25(30)17-28(3)26(31)14-15-29-21-8-4-6-10-23(21)32-24-11-7-5-9-22(24)29/h4-13,16H,14-15,17H2,1-3H3,(H,27,30) |
| InChIKey | YKSPDKHSZAVKLN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|