C19H25N3O3S2 — CID 9479725
N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide (PubChem CID 9479725) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide.
| Compound Name | N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 9479725 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[2-(2,5-dimethylanilino)-2-oxoethyl]-N-methyl-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)CCCCN2C(=O)CSC2=S)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-13-7-8-14(2)15(10-13)20-16(23)11-21(3)17(24)6-4-5-9-22-18(25)12-27-19(22)26/h7-8,10H,4-6,9,11-12H2,1-3H3,(H,20,23) |
| InChIKey | GUGQDWHEAYVSOH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|