C24H22FN3O2S2 — CID 4222972
2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4222972) has the molecular formula C24H22FN3O2S2 and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4222972 |
| Molecular Formula | C24H22FN3O2S2 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]sulfanyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C(=O)CSc2nc3sc4c(c3c(=O)[nH]2)CCCC4)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN3O2S2/c1-13-11-18(14(2)28(13)16-9-7-15(25)8-10-16)19(29)12-31-24-26-22(30)21-17-5-3-4-6-20(17)32-23(21)27-24/h7-11H,3-6,12H2,1-2H3,(H,26,27,30) |
| InChIKey | PHKRVGZWSYBMFO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|