C25H25N3O2S2 — CID 3534642
1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone (PubChem CID 3534642) has the molecular formula C25H25N3O2S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone.
| Compound Name | 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 3534642 |
| Molecular Formula | C25H25N3O2S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)ethanone |
| SMILES | CCOc1ccc(-n2c(C)cc(C(=O)CSc3ncnc4sc5c(c34)CCC5)c2C)cc1 |
| InChI | InChI=1S/C25H25N3O2S2/c1-4-30-18-10-8-17(9-11-18)28-15(2)12-20(16(28)3)21(29)13-31-24-23-19-6-5-7-22(19)32-25(23)27-14-26-24/h8-12,14H,4-7,13H2,1-3H3 |
| InChIKey | GHAUJMOBYPMUJD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|