C26H33N3O2 — CID 42238884
(4aR,8aS)-1-(2-cyclohexylethyl)-6-(quinoline-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42238884) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (4aR,8aS)-1-(2-cyclohexylethyl)-6-(quinoline-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(2-cyclohexylethyl)-6-(quinoline-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42238884 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (4aR,8aS)-1-(2-cyclohexylethyl)-6-(quinoline-2-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1ccc2ccccc2n1)N1CC[C@H]2[C@H](CCC(=O)N2CCC2CCCCC2)C1 |
| InChI | InChI=1S/C26H33N3O2/c30-25-13-11-21-18-28(26(31)23-12-10-20-8-4-5-9-22(20)27-23)16-15-24(21)29(25)17-14-19-6-2-1-3-7-19/h4-5,8-10,12,19,21,24H,1-3,6-7,11,13-18H2/t21-,24+/m1/s1 |
| InChIKey | SVRBWEPUIZQGIN-QPPBQGQZSA-N |
| XLogP | 4.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |