C24H25N3O2 — CID 56877971
4-benzyl-3-ethyl-1-(quinoline-2-carbonyl)-1,4-diazepan-5-one (PubChem CID 56877971) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-1-(quinoline-2-carbonyl)-1,4-diazepan-5-one.
| Compound Name | 4-benzyl-3-ethyl-1-(quinoline-2-carbonyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56877971 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-benzyl-3-ethyl-1-(quinoline-2-carbonyl)-1,4-diazepan-5-one |
| SMILES | CCC1CN(C(=O)c2ccc3ccccc3n2)CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H25N3O2/c1-2-20-17-26(15-14-23(28)27(20)16-18-8-4-3-5-9-18)24(29)22-13-12-19-10-6-7-11-21(19)25-22/h3-13,20H,2,14-17H2,1H3 |
| InChIKey | HUVWIQFDJJIUAE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |