C19H20Cl2N2O3S — CID 4223997
methyl 2-[(3,4-dichlorophenyl)carbamoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 4223997) has the molecular formula C19H20Cl2N2O3S and a molecular weight of 427.35 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)carbamoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,4-dichlorophenyl)carbamoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4223997 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | methyl 2-[(3,4-dichlorophenyl)carbamoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)Nc2ccc(Cl)c(Cl)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-26-18(24)16-12-6-4-2-3-5-7-15(12)27-17(16)23-19(25)22-11-8-9-13(20)14(21)10-11/h8-10H,2-7H2,1H3,(H2,22,23,25) |
| InChIKey | SIWFFMSSUSYBCB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |