C18H17Cl2N3OS — CID 4161746
1-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 4161746) has the molecular formula C18H17Cl2N3OS and a molecular weight of 394.33 g/mol. Its IUPAC name is 1-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 4161746 |
| Molecular Formula | C18H17Cl2N3OS |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | N#Cc1c(NC(=O)Nc2ccc(Cl)c(Cl)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C18H17Cl2N3OS/c19-14-8-7-11(9-15(14)20)22-18(24)23-17-13(10-21)12-5-3-1-2-4-6-16(12)25-17/h7-9H,1-6H2,(H2,22,23,24) |
| InChIKey | YXPNBLOAZWOCNR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |