C20H18Cl2N2OS — CID 4569283
N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 4569283) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4569283 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#Cc1c(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C20H18Cl2N2OS/c21-16-9-7-13(11-17(16)22)8-10-19(25)24-20-15(12-23)14-5-3-1-2-4-6-18(14)26-20/h7-11H,1-6H2,(H,24,25) |
| InChIKey | YMAWDJYMLPGSBQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|