C20H16Cl2N2OS2 — CID 19227059
(E)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 19227059) has the molecular formula C20H16Cl2N2OS2 and a molecular weight of 435.40 g/mol. Its IUPAC name is (E)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19227059 |
| Molecular Formula | C20H16Cl2N2OS2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | (E)-N-(4-cyano-7-methyl-1-sulfanylidene-5,6,7,8-tetrahydroisothiochromen-3-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC1CCc2c(C#N)c(NC(=O)/C=C/c3ccc(Cl)c(Cl)c3)sc(=S)c2C1 |
| InChI | InChI=1S/C20H16Cl2N2OS2/c1-11-2-5-13-14(8-11)20(26)27-19(15(13)10-23)24-18(25)7-4-12-3-6-16(21)17(22)9-12/h3-4,6-7,9,11H,2,5,8H2,1H3,(H,24,25)/b7-4+ |
| InChIKey | YUBREYZZAZLOEZ-QPJJXVBHSA-N |
| XLogP | 6.43 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|