C19H16N6OS — CID 16652473
(E)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 16652473) has the molecular formula C19H16N6OS and a molecular weight of 376.45 g/mol. Its IUPAC name is (E)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16652473 |
| Molecular Formula | C19H16N6OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (E)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | N#Cc1c(NC(=O)/C=C/c2cccc(-n3cnnn3)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H16N6OS/c20-11-16-15-6-1-2-7-17(15)27-19(16)22-18(26)9-8-13-4-3-5-14(10-13)25-12-21-23-24-25/h3-5,8-10,12H,1-2,6-7H2,(H,22,26)/b9-8+ |
| InChIKey | SBLDIMWWLJDOPV-CMDGGOBGSA-N |
| XLogP | 3.13 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|