C18H17N5O3S — CID 16652493
methyl 4,5-dimethyl-2-[[(E)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 16652493) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-[[(E)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-[[(E)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 16652493 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 4,5-dimethyl-2-[[(E)-3-[3-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C=C/c2cccc(-n3cnnn3)c2)sc(C)c1C |
| InChI | InChI=1S/C18H17N5O3S/c1-11-12(2)27-17(16(11)18(25)26-3)20-15(24)8-7-13-5-4-6-14(9-13)23-10-19-21-22-23/h4-10H,1-3H3,(H,20,24)/b8-7+ |
| InChIKey | GEJJPMLPNFKMPE-BQYQJAHWSA-N |
| XLogP | 2.78 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|