C21H18N6OS — CID 16652477
(E)-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 16652477) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is (E)-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16652477 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]-3-[3-(tetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)/C=C/c3cccc(-n4cnnn4)c3)s2)cc1 |
| InChI | InChI=1S/C21H18N6OS/c1-15-5-7-17(8-6-15)12-19-13-22-21(29-19)24-20(28)10-9-16-3-2-4-18(11-16)27-14-23-25-26-27/h2-11,13-14H,12H2,1H3,(H,22,24,28)/b10-9+ |
| InChIKey | VUTWETBRVIBRPC-MDZDMXLPSA-N |
| XLogP | 3.67 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|