C19H30N2OS — CID 42242327
N-[[(3R)-1-methylpiperidin-3-yl]methyl]-3-methylsulfanyl-N-(2-phenylethyl)propanamide (PubChem CID 42242327) has the molecular formula C19H30N2OS and a molecular weight of 334.53 g/mol. Its IUPAC name is N-[[(3R)-1-methylpiperidin-3-yl]methyl]-3-methylsulfanyl-N-(2-phenylethyl)propanamide.
| Compound Name | N-[[(3R)-1-methylpiperidin-3-yl]methyl]-3-methylsulfanyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 42242327 |
| Molecular Formula | C19H30N2OS |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[[(3R)-1-methylpiperidin-3-yl]methyl]-3-methylsulfanyl-N-(2-phenylethyl)propanamide |
| SMILES | CSCCC(=O)N(CCc1ccccc1)C[C@@H]1CCCN(C)C1 |
| InChI | InChI=1S/C19H30N2OS/c1-20-12-6-9-18(15-20)16-21(19(22)11-14-23-2)13-10-17-7-4-3-5-8-17/h3-5,7-8,18H,6,9-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | WNTFEVVCMGVUFK-GOSISDBHSA-N |
| XLogP | 3.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |