C22H30N2OS — CID 45222782
1-[4-[[(1-methylpiperidin-3-yl)methyl-(2-phenylethyl)amino]methyl]thiophen-2-yl]ethanone (PubChem CID 45222782) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is 1-[4-[[(1-methylpiperidin-3-yl)methyl-(2-phenylethyl)amino]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[(1-methylpiperidin-3-yl)methyl-(2-phenylethyl)amino]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 45222782 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[4-[[(1-methylpiperidin-3-yl)methyl-(2-phenylethyl)amino]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN(CCc2ccccc2)CC2CCCN(C)C2)cs1 |
| InChI | InChI=1S/C22H30N2OS/c1-18(25)22-13-21(17-26-22)16-24(12-10-19-7-4-3-5-8-19)15-20-9-6-11-23(2)14-20/h3-5,7-8,13,17,20H,6,9-12,14-16H2,1-2H3 |
| InChIKey | JRSSFAYQFFNANL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |