C18H32N2O — CID 42244222
(5R)-7-(2,2-dimethylpropyl)-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 42244222) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is (5R)-7-(2,2-dimethylpropyl)-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5R)-7-(2,2-dimethylpropyl)-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 42244222 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (5R)-7-(2,2-dimethylpropyl)-2-[(E)-2-methylbut-2-enyl]-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | C/C=C(\C)CN1CC[C@]2(CCCN(CC(C)(C)C)C2=O)C1 |
| InChI | InChI=1S/C18H32N2O/c1-6-15(2)12-19-11-9-18(14-19)8-7-10-20(16(18)21)13-17(3,4)5/h6H,7-14H2,1-5H3/b15-6+/t18-/m1/s1 |
| InChIKey | HDAFYYCSXWCGCL-PRWGNSRSSA-N |
| XLogP | 3.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|