C22H22N6O3S — CID 42244876
N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazole-3-carboxamide (PubChem CID 42244876) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 42244876 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-methyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-5-[[4-(1,2,4-triazol-1-yl)phenoxy]methyl]-1,2-oxazole-3-carboxamide |
| SMILES | CN(Cc1nc2c(s1)CCCC2)C(=O)c1cc(COc2ccc(-n3cncn3)cc2)on1 |
| InChI | InChI=1S/C22H22N6O3S/c1-27(11-21-25-18-4-2-3-5-20(18)32-21)22(29)19-10-17(31-26-19)12-30-16-8-6-15(7-9-16)28-14-23-13-24-28/h6-10,13-14H,2-5,11-12H2,1H3 |
| InChIKey | IIGRLVXJOXZJRH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |