C10H6N2OS2 — CID 4224794
3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzonitrile (PubChem CID 4224794) has the molecular formula C10H6N2OS2 and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzonitrile.
| Compound Name | 3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 4224794 |
| Molecular Formula | C10H6N2OS2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2C(=O)CSC2=S)c1 |
| InChI | InChI=1S/C10H6N2OS2/c11-5-7-2-1-3-8(4-7)12-9(13)6-15-10(12)14/h1-4H,6H2 |
| InChIKey | XINQIMCMPOABEI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|