C33H24Cl2FN3O8 — CID 4224939
6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4224939) has the molecular formula C33H24Cl2FN3O8 and a molecular weight of 680.47 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4224939 |
| Molecular Formula | C33H24Cl2FN3O8 |
| Molecular Weight | 680.47 g/mol |
| Exact Mass | 679.09 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxy-2-methoxyphenyl)-2-(3-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C3C2CC2(Cl)C(=O)N(c3ccc(F)cc3)C(=O)C12Cl |
| InChI | InChI=1S/C33H24Cl2FN3O8/c1-47-25-14-20(40)9-10-22(25)27-21-11-12-23-26(29(42)37(28(23)41)18-3-2-4-19(13-18)39(45)46)24(21)15-32(34)30(43)38(31(44)33(27,32)35)17-7-5-16(36)6-8-17/h2-11,13-14,23-24,26-27,40H,12,15H2,1H3 |
| InChIKey | PEMKUQBICOWQKO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|