C32H22Cl2FN3O7 — CID 4290735
6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4290735) has the molecular formula C32H22Cl2FN3O7 and a molecular weight of 650.45 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4290735 |
| Molecular Formula | C32H22Cl2FN3O7 |
| Molecular Weight | 650.45 g/mol |
| Exact Mass | 649.08 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(4-hydroxyphenyl)-2-(4-nitrophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3ccc(O)cc3)C2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H22Cl2FN3O7/c33-31-15-24-22(13-14-23-25(24)28(41)36(27(23)40)18-7-9-20(10-8-18)38(44)45)26(16-1-11-21(39)12-2-16)32(31,34)30(43)37(29(31)42)19-5-3-17(35)4-6-19/h1-13,23-26,39H,14-15H2 |
| InChIKey | OOSQATRJKAHBCY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|