C28H34N6O — CID 42274068
[5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)pyrazol-4-yl]-[(3S)-3-(diethylamino)pyrrolidin-1-yl]methanone (PubChem CID 42274068) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is [5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)pyrazol-4-yl]-[(3S)-3-(diethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | [5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)pyrazol-4-yl]-[(3S)-3-(diethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42274068 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | [5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)pyrazol-4-yl]-[(3S)-3-(diethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CCN(CC)[C@H]1CCN(C(=O)c2cnn(-c3ncc4c(n3)-c3ccccc3CCC4)c2C2CC2)C1 |
| InChI | InChI=1S/C28H34N6O/c1-3-32(4-2)22-14-15-33(18-22)27(35)24-17-30-34(26(24)20-12-13-20)28-29-16-21-10-7-9-19-8-5-6-11-23(19)25(21)31-28/h5-6,8,11,16-17,20,22H,3-4,7,9-10,12-15,18H2,1-2H3/t22-/m0/s1 |
| InChIKey | RVTCQBUXMXZTLO-QFIPXVFZSA-N |
| XLogP | 4.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |