C26H32N6O — CID 42378655
[1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-methylpyrazol-4-yl]-[(3R)-3-(diethylamino)pyrrolidin-1-yl]methanone (PubChem CID 42378655) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-methylpyrazol-4-yl]-[(3R)-3-(diethylamino)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-methylpyrazol-4-yl]-[(3R)-3-(diethylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42378655 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-5-methylpyrazol-4-yl]-[(3R)-3-(diethylamino)pyrrolidin-1-yl]methanone |
| SMILES | CCN(CC)[C@@H]1CCN(C(=O)c2cnn(-c3ncc4c(n3)-c3ccccc3CCC4)c2C)C1 |
| InChI | InChI=1S/C26H32N6O/c1-4-30(5-2)21-13-14-31(17-21)25(33)23-16-28-32(18(23)3)26-27-15-20-11-8-10-19-9-6-7-12-22(19)24(20)29-26/h6-7,9,12,15-16,21H,4-5,8,10-11,13-14,17H2,1-3H3/t21-/m1/s1 |
| InChIKey | PNHWAENXUNNNLE-OAQYLSRUSA-N |
| XLogP | 3.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |