About (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol
(S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol (PubChem CID 42277346) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol |
| PubChem CID | 42277346 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol |
| SMILES | CCCN1CCOc2ccc([C@H](O)c3cccnc3)cc2C1 |
| InChI | InChI=1S/C18H22N2O2/c1-2-8-20-9-10-22-17-6-5-14(11-16(17)13-20)18(21)15-4-3-7-19-12-15/h3-7,11-12,18,21H,2,8-10,13H2,1H3/t18-/m0/s1 |
| InChIKey | MHEBKTJZAPMSHA-SFHVURJKSA-N |
| XLogP | 2.77 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol?
The IUPAC name of (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol (CID 42277346) is (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol.
What is the SMILES notation for (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol?
The canonical SMILES for (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol is CCCN1CCOc2ccc([C@H](O)c3cccnc3)cc2C1.
What is the InChIKey of (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol?
The InChIKey is MHEBKTJZAPMSHA-SFHVURJKSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-2-8-20-9-10-22-17-6-5-14(11-16(17)13-20)18(21)15-4-3-7-19-12-15/h3-7,11-12,18,21H,2,8-10,13H2,1H3/t18-/m0/s1.
What are the key properties of (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol?
(S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol has a molecular weight of 298.39 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(4-propyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-pyridin-3-ylmethanol is sourced from PubChem (CID 42277346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).