C26H29NO6S — CID 42278428
(5R)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 42278428) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is (5R)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 42278428 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (5R)-1-[(3S)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C(O)=C2C(=O)C(=O)N([C@H]3CCS(=O)(=O)C3)[C@@H]2c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C26H29NO6S/c1-4-33-21-7-5-6-19(14-21)24(28)22-23(18-10-8-17(9-11-18)16(2)3)27(26(30)25(22)29)20-12-13-34(31,32)15-20/h5-11,14,16,20,23,28H,4,12-13,15H2,1-3H3/t20-,23+/m0/s1 |
| InChIKey | KIPURPRGVAOVQA-NZQKXSOJSA-N |
| XLogP | 3.82 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|