C23H22BrNO6S — CID 42278431
(5R)-5-(4-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 42278431) has the molecular formula C23H22BrNO6S and a molecular weight of 520.40 g/mol. Its IUPAC name is (5R)-5-(4-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(4-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 42278431 |
| Molecular Formula | C23H22BrNO6S |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | (5R)-5-(4-bromophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C(O)=C2C(=O)C(=O)N([C@@H]3CCS(=O)(=O)C3)[C@@H]2c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H22BrNO6S/c1-2-31-18-5-3-4-15(12-18)21(26)19-20(14-6-8-16(24)9-7-14)25(23(28)22(19)27)17-10-11-32(29,30)13-17/h3-9,12,17,20,26H,2,10-11,13H2,1H3/t17-,20-/m1/s1 |
| InChIKey | UHUHVXORZMOSNF-YLJYHZDGSA-N |
| XLogP | 3.46 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|