C23H21NO7S — CID 98344513
methyl 4-[(2R,3Z)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 98344513) has the molecular formula C23H21NO7S and a molecular weight of 455.49 g/mol. Its IUPAC name is methyl 4-[(2R,3Z)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,3Z)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 98344513 |
| Molecular Formula | C23H21NO7S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | methyl 4-[(2R,3Z)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-[hydroxy(phenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2/C(=C(/O)c3ccccc3)C(=O)C(=O)N2[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H21NO7S/c1-31-23(28)16-9-7-14(8-10-16)19-18(20(25)15-5-3-2-4-6-15)21(26)22(27)24(19)17-11-12-32(29,30)13-17/h2-10,17,19,25H,11-13H2,1H3/b20-18-/t17-,19-/m1/s1 |
| InChIKey | HUUWHALUTPIIJL-JUZCTFJNSA-N |
| XLogP | 2.08 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|