C25H25ClN2O7S2 — CID 73262909
5-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 73262909) has the molecular formula C25H25ClN2O7S2 and a molecular weight of 565.07 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 73262909 |
| Molecular Formula | C25H25ClN2O7S2 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)-4-[hydroxy-(4-pyrrolidin-1-ylsulfonylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(C2CCS(=O)(=O)C2)C(c2ccc(Cl)cc2)C1=C(O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H25ClN2O7S2/c26-18-7-3-16(4-8-18)22-21(24(30)25(31)28(22)19-11-14-36(32,33)15-19)23(29)17-5-9-20(10-6-17)37(34,35)27-12-1-2-13-27/h3-10,19,22,29H,1-2,11-15H2 |
| InChIKey | UDSMFTAMDCHACW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|