C25H26FNO6S — CID 71581320
(4E)-1-(1,1-dioxothiolan-3-yl)-5-(2-fluorophenyl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 71581320) has the molecular formula C25H26FNO6S and a molecular weight of 487.55 g/mol. Its IUPAC name is (4E)-1-(1,1-dioxothiolan-3-yl)-5-(2-fluorophenyl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1,1-dioxothiolan-3-yl)-5-(2-fluorophenyl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 71581320 |
| Molecular Formula | C25H26FNO6S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | (4E)-1-(1,1-dioxothiolan-3-yl)-5-(2-fluorophenyl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CC(C)COc1ccc(/C(O)=C2\C(=O)C(=O)N(C3CCS(=O)(=O)C3)C2c2ccccc2F)cc1 |
| InChI | InChI=1S/C25H26FNO6S/c1-15(2)13-33-18-9-7-16(8-10-18)23(28)21-22(19-5-3-4-6-20(19)26)27(25(30)24(21)29)17-11-12-34(31,32)14-17/h3-10,15,17,22,28H,11-14H2,1-2H3/b23-21+ |
| InChIKey | YLECKFZIBZRIGF-XTQSDGFTSA-N |
| XLogP | 3.47 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|