C21H21ClN2O6 — CID 42280913
(2-chloro-4-nitrophenyl)-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 42280913) has the molecular formula C21H21ClN2O6 and a molecular weight of 432.86 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 42280913 |
| Molecular Formula | C21H21ClN2O6 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[4-(2,4,6-trimethoxyphenyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | COc1cc(OC)c(C2=CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H21ClN2O6/c1-28-15-11-18(29-2)20(19(12-15)30-3)13-6-8-23(9-7-13)21(25)16-5-4-14(24(26)27)10-17(16)22/h4-6,10-12H,7-9H2,1-3H3 |
| InChIKey | KFHHSJULBNUUGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|