C8H14N2 — CID 42282040
(1,2,5-trimethylpyrrol-3-yl)methanamine (PubChem CID 42282040) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1,2,5-trimethylpyrrol-3-yl)methanamine.
| Compound Name | (1,2,5-trimethylpyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 42282040 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1,2,5-trimethylpyrrol-3-yl)methanamine |
| SMILES | Cc1cc(CN)c(C)n1C |
| InChI | InChI=1S/C8H14N2/c1-6-4-8(5-9)7(2)10(6)3/h4H,5,9H2,1-3H3 |
| InChIKey | QDKVKIHUOVMMCG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |