C14H15ClF3N3O2S — CID 42282516
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methyl-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 42282516) has the molecular formula C14H15ClF3N3O2S and a molecular weight of 381.81 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methyl-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methyl-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42282516 |
| Molecular Formula | C14H15ClF3N3O2S |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methyl-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)C)cc1S(=O)(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H15ClF3N3O2S/c1-8(2)21-7-13(9(3)19-21)24(22,23)20-12-6-10(14(16,17)18)4-5-11(12)15/h4-8,20H,1-3H3 |
| InChIKey | BAOHZEQAEUUGKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |