C16H17N3O3S2 — CID 42285261
N-(4-hydroxyphenyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42285261) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(4-hydroxyphenyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42285261 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(4-hydroxyphenyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | CC(C)n1cc(S(=O)(=O)Nc2ccc(O)cc2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C16H17N3O3S2/c1-11(2)19-10-15(16(17-19)14-4-3-9-23-14)24(21,22)18-12-5-7-13(20)8-6-12/h3-11,18,20H,1-2H3 |
| InChIKey | GATQKBZXVREWHZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|